C14H26BrN3 — CID 81016090
4-(4-bromo-1,3-dimethylpyrazol-5-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine (PubChem CID 81016090) has the molecular formula C14H26BrN3 and a molecular weight of 316.29 g/mol. Its IUPAC name is 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine.
| Compound Name | 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine |
|---|---|
| PubChem CID | 81016090 |
| Molecular Formula | C14H26BrN3 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine |
| SMILES | Cc1nn(C)c(CC(C)CCNCC(C)C)c1Br |
| InChI | InChI=1S/C14H26BrN3/c1-10(2)9-16-7-6-11(3)8-13-14(15)12(4)17-18(13)5/h10-11,16H,6-9H2,1-5H3 |
| InChIKey | RJTDBJIUIMPKEF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|