C13H24BrN3 — CID 62448251
3-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(2-methylpropyl)butan-1-amine (PubChem CID 62448251) has the molecular formula C13H24BrN3 and a molecular weight of 302.26 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(2-methylpropyl)butan-1-amine.
| Compound Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(2-methylpropyl)butan-1-amine |
|---|---|
| PubChem CID | 62448251 |
| Molecular Formula | C13H24BrN3 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(2-methylpropyl)butan-1-amine |
| SMILES | Cc1nn(C(C)CCNCC(C)C)c(C)c1Br |
| InChI | InChI=1S/C13H24BrN3/c1-9(2)8-15-7-6-10(3)17-12(5)13(14)11(4)16-17/h9-10,15H,6-8H2,1-5H3 |
| InChIKey | IFXCYFVWXRJVSY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|