C13H16F3N — CID 81018961
N-[3-(2,3,4-trifluorophenyl)butyl]cyclopropanamine (PubChem CID 81018961) has the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. Its IUPAC name is N-[3-(2,3,4-trifluorophenyl)butyl]cyclopropanamine.
| Compound Name | N-[3-(2,3,4-trifluorophenyl)butyl]cyclopropanamine |
|---|---|
| PubChem CID | 81018961 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | N-[3-(2,3,4-trifluorophenyl)butyl]cyclopropanamine |
| SMILES | CC(CCNC1CC1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H16F3N/c1-8(6-7-17-9-2-3-9)10-4-5-11(14)13(16)12(10)15/h4-5,8-9,17H,2-3,6-7H2,1H3 |
| InChIKey | VBQISKFGEPGBDM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|