C16H24N2O2 — CID 81020825
2-[(2-amino-4-pyridinyl)methyl]-4-propan-2-ylcyclohexane-1-carboxylic acid (PubChem CID 81020825) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-[(2-amino-4-pyridinyl)methyl]-4-propan-2-ylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[(2-amino-4-pyridinyl)methyl]-4-propan-2-ylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81020825 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-[(2-amino-4-pyridinyl)methyl]-4-propan-2-ylcyclohexane-1-carboxylic acid |
| SMILES | CC(C)C1CCC(C(=O)O)C(Cc2ccnc(N)c2)C1 |
| InChI | InChI=1S/C16H24N2O2/c1-10(2)12-3-4-14(16(19)20)13(9-12)7-11-5-6-18-15(17)8-11/h5-6,8,10,12-14H,3-4,7,9H2,1-2H3,(H2,17,18)(H,19,20) |
| InChIKey | OKZVXIAHYFOGRT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |