About 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine
4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine (PubChem CID 112743681) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine |
| PubChem CID | 112743681 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine |
| SMILES | Nc1cc(CC(N)C(C2CC2)C2CC2)ccn1 |
| InChI | InChI=1S/C14H21N3/c15-12(7-9-5-6-17-13(16)8-9)14(10-1-2-10)11-3-4-11/h5-6,8,10-12,14H,1-4,7,15H2,(H2,16,17) |
| InChIKey | FHTMQGCKQZKHPZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine?
The IUPAC name of 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine (CID 112743681) is 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine.
What is the SMILES notation for 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine?
The canonical SMILES for 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine is Nc1cc(CC(N)C(C2CC2)C2CC2)ccn1.
What is the InChIKey of 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine?
The InChIKey is FHTMQGCKQZKHPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3/c15-12(7-9-5-6-17-13(16)8-9)14(10-1-2-10)11-3-4-11/h5-6,8,10-12,14H,1-4,7,15H2,(H2,16,17).
What are the key properties of 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine?
4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine has a molecular weight of 231.34 g/mol, XLogP of 1.97, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-3,3-dicyclopropylpropyl)pyridin-2-amine is sourced from PubChem (CID 112743681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).