C19H33NS — CID 81026188
2-methyl-N-[[2-(5-methylthiophen-3-yl)-4-propan-2-ylcyclohexyl]methyl]propan-1-amine (PubChem CID 81026188) has the molecular formula C19H33NS and a molecular weight of 307.55 g/mol. Its IUPAC name is 2-methyl-N-[[2-(5-methylthiophen-3-yl)-4-propan-2-ylcyclohexyl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[2-(5-methylthiophen-3-yl)-4-propan-2-ylcyclohexyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81026188 |
| Molecular Formula | C19H33NS |
| Molecular Weight | 307.55 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 2-methyl-N-[[2-(5-methylthiophen-3-yl)-4-propan-2-ylcyclohexyl]methyl]propan-1-amine |
| SMILES | Cc1cc(C2CC(C(C)C)CCC2CNCC(C)C)cs1 |
| InChI | InChI=1S/C19H33NS/c1-13(2)10-20-11-17-7-6-16(14(3)4)9-19(17)18-8-15(5)21-12-18/h8,12-14,16-17,19-20H,6-7,9-11H2,1-5H3 |
| InChIKey | JQGXZFQSIOCMTL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |