C18H30BrNS — CID 81026302
N-[[2-(4-bromothiophen-3-yl)-4-propan-2-ylcyclohexyl]methyl]-2-methylpropan-1-amine (PubChem CID 81026302) has the molecular formula C18H30BrNS and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[[2-(4-bromothiophen-3-yl)-4-propan-2-ylcyclohexyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[2-(4-bromothiophen-3-yl)-4-propan-2-ylcyclohexyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 81026302 |
| Molecular Formula | C18H30BrNS |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[[2-(4-bromothiophen-3-yl)-4-propan-2-ylcyclohexyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC1CCC(C(C)C)CC1c1cscc1Br |
| InChI | InChI=1S/C18H30BrNS/c1-12(2)8-20-9-15-6-5-14(13(3)4)7-16(15)17-10-21-11-18(17)19/h10-16,20H,5-9H2,1-4H3 |
| InChIKey | HAFIVADJYYJQSW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |