C19H28ClN — CID 81026555
N-[[2-(3-chlorophenyl)-4-propylcyclohexyl]methyl]cyclopropanamine (PubChem CID 81026555) has the molecular formula C19H28ClN and a molecular weight of 305.89 g/mol. Its IUPAC name is N-[[2-(3-chlorophenyl)-4-propylcyclohexyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(3-chlorophenyl)-4-propylcyclohexyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 81026555 |
| Molecular Formula | C19H28ClN |
| Molecular Weight | 305.89 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N-[[2-(3-chlorophenyl)-4-propylcyclohexyl]methyl]cyclopropanamine |
| SMILES | CCCC1CCC(CNC2CC2)C(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H28ClN/c1-2-4-14-7-8-16(13-21-18-9-10-18)19(11-14)15-5-3-6-17(20)12-15/h3,5-6,12,14,16,18-19,21H,2,4,7-11,13H2,1H3 |
| InChIKey | WTNRSVFSLBAYQC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.89 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |