C13H13BrClN3O — CID 81027249
N-(2-bromo-4-chlorophenyl)-2-ethyl-5-methylpyrazole-3-carboxamide (PubChem CID 81027249) has the molecular formula C13H13BrClN3O and a molecular weight of 342.62 g/mol. Its IUPAC name is N-(2-bromo-4-chlorophenyl)-2-ethyl-5-methylpyrazole-3-carboxamide.
| Compound Name | N-(2-bromo-4-chlorophenyl)-2-ethyl-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 81027249 |
| Molecular Formula | C13H13BrClN3O |
| Molecular Weight | 342.62 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | N-(2-bromo-4-chlorophenyl)-2-ethyl-5-methylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)Nc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C13H13BrClN3O/c1-3-18-12(6-8(2)17-18)13(19)16-11-5-4-9(15)7-10(11)14/h4-7H,3H2,1-2H3,(H,16,19) |
| InChIKey | SXLSLTAQAJVUDO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |