C11H12ClN5O — CID 107595898
N-(5-chloropyrazin-2-yl)-2-ethyl-5-methylpyrazole-3-carboxamide (PubChem CID 107595898) has the molecular formula C11H12ClN5O and a molecular weight of 265.70 g/mol. Its IUPAC name is N-(5-chloropyrazin-2-yl)-2-ethyl-5-methylpyrazole-3-carboxamide.
| Compound Name | N-(5-chloropyrazin-2-yl)-2-ethyl-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107595898 |
| Molecular Formula | C11H12ClN5O |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-(5-chloropyrazin-2-yl)-2-ethyl-5-methylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)Nc1cnc(Cl)cn1 |
| InChI | InChI=1S/C11H12ClN5O/c1-3-17-8(4-7(2)16-17)11(18)15-10-6-13-9(12)5-14-10/h4-6H,3H2,1-2H3,(H,14,15,18) |
| InChIKey | QMMSRMPZHSXIBB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |