C18H35N — CID 81030772
N-[(4-tert-butyl-2-cyclopropylcyclohexyl)methyl]-2-methylpropan-2-amine (PubChem CID 81030772) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is N-[(4-tert-butyl-2-cyclopropylcyclohexyl)methyl]-2-methylpropan-2-amine.
| Compound Name | N-[(4-tert-butyl-2-cyclopropylcyclohexyl)methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 81030772 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | N-[(4-tert-butyl-2-cyclopropylcyclohexyl)methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCC1CCC(C(C)(C)C)CC1C1CC1 |
| InChI | InChI=1S/C18H35N/c1-17(2,3)15-10-9-14(12-19-18(4,5)6)16(11-15)13-7-8-13/h13-16,19H,7-12H2,1-6H3 |
| InChIKey | DFUSTBCKQCDZEM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |