C18H37NO — CID 81030544
N-[[4-tert-butyl-2-(ethoxymethyl)cyclohexyl]methyl]-2-methylpropan-2-amine (PubChem CID 81030544) has the molecular formula C18H37NO and a molecular weight of 283.50 g/mol. Its IUPAC name is N-[[4-tert-butyl-2-(ethoxymethyl)cyclohexyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[4-tert-butyl-2-(ethoxymethyl)cyclohexyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 81030544 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | N-[[4-tert-butyl-2-(ethoxymethyl)cyclohexyl]methyl]-2-methylpropan-2-amine |
| SMILES | CCOCC1CC(C(C)(C)C)CCC1CNC(C)(C)C |
| InChI | InChI=1S/C18H37NO/c1-8-20-13-15-11-16(17(2,3)4)10-9-14(15)12-19-18(5,6)7/h14-16,19H,8-13H2,1-7H3 |
| InChIKey | NYGXQRKBCMHOAI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |