C17H26IN — CID 81031877
N-[[2-[(4-iodophenyl)methyl]-4-methylcyclohexyl]methyl]ethanamine (PubChem CID 81031877) has the molecular formula C17H26IN and a molecular weight of 371.31 g/mol. Its IUPAC name is N-[[2-[(4-iodophenyl)methyl]-4-methylcyclohexyl]methyl]ethanamine.
| Compound Name | N-[[2-[(4-iodophenyl)methyl]-4-methylcyclohexyl]methyl]ethanamine |
|---|---|
| PubChem CID | 81031877 |
| Molecular Formula | C17H26IN |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[[2-[(4-iodophenyl)methyl]-4-methylcyclohexyl]methyl]ethanamine |
| SMILES | CCNCC1CCC(C)CC1Cc1ccc(I)cc1 |
| InChI | InChI=1S/C17H26IN/c1-3-19-12-15-7-4-13(2)10-16(15)11-14-5-8-17(18)9-6-14/h5-6,8-9,13,15-16,19H,3-4,7,10-12H2,1-2H3 |
| InChIKey | NLVRKKVJRLPWSU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|