C7H9Cl2N3OS — CID 81036593
3,6-dichloro-5-(3-methoxypropylsulfanyl)-1,2,4-triazine (PubChem CID 81036593) has the molecular formula C7H9Cl2N3OS and a molecular weight of 254.14 g/mol. Its IUPAC name is 3,6-dichloro-5-(3-methoxypropylsulfanyl)-1,2,4-triazine.
| Compound Name | 3,6-dichloro-5-(3-methoxypropylsulfanyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 81036593 |
| Molecular Formula | C7H9Cl2N3OS |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 3,6-dichloro-5-(3-methoxypropylsulfanyl)-1,2,4-triazine |
| SMILES | COCCCSc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C7H9Cl2N3OS/c1-13-3-2-4-14-6-5(8)11-12-7(9)10-6/h2-4H2,1H3 |
| InChIKey | ITRWWACOYWDHJC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|