C13H26N2O3S — CID 81039232
6-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-4-ethylhexanamide (PubChem CID 81039232) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is 6-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-4-ethylhexanamide.
| Compound Name | 6-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-4-ethylhexanamide |
|---|---|
| PubChem CID | 81039232 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 6-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-4-ethylhexanamide |
| SMILES | CCC(CCN)CCC(=O)NCC1CCCS1(=O)=O |
| InChI | InChI=1S/C13H26N2O3S/c1-2-11(7-8-14)5-6-13(16)15-10-12-4-3-9-19(12,17)18/h11-12H,2-10,14H2,1H3,(H,15,16) |
| InChIKey | AMEHCASSWZXVSQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |