C11H22N2O3S — CID 81040634
N-butan-2-yl-2-[(1,1-dioxothiolan-2-yl)methylamino]acetamide (PubChem CID 81040634) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is N-butan-2-yl-2-[(1,1-dioxothiolan-2-yl)methylamino]acetamide.
| Compound Name | N-butan-2-yl-2-[(1,1-dioxothiolan-2-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 81040634 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-butan-2-yl-2-[(1,1-dioxothiolan-2-yl)methylamino]acetamide |
| SMILES | CCC(C)NC(=O)CNCC1CCCS1(=O)=O |
| InChI | InChI=1S/C11H22N2O3S/c1-3-9(2)13-11(14)8-12-7-10-5-4-6-17(10,15)16/h9-10,12H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | BSZXUBJFZKNJDM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |