C11H21NO4S — CID 81039682
ethyl 2-[(1,1-dioxothiolan-2-yl)methylamino]butanoate (PubChem CID 81039682) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is ethyl 2-[(1,1-dioxothiolan-2-yl)methylamino]butanoate.
| Compound Name | ethyl 2-[(1,1-dioxothiolan-2-yl)methylamino]butanoate |
|---|---|
| PubChem CID | 81039682 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | ethyl 2-[(1,1-dioxothiolan-2-yl)methylamino]butanoate |
| SMILES | CCOC(=O)C(CC)NCC1CCCS1(=O)=O |
| InChI | InChI=1S/C11H21NO4S/c1-3-10(11(13)16-4-2)12-8-9-6-5-7-17(9,14)15/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | VFEDHNNLGIPCGD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |