C10H18N2O4S — CID 81039320
N-[(1,1-dioxothiolan-2-yl)methyl]morpholine-3-carboxamide (PubChem CID 81039320) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]morpholine-3-carboxamide.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 81039320 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]morpholine-3-carboxamide |
| SMILES | O=C(NCC1CCCS1(=O)=O)C1COCCN1 |
| InChI | InChI=1S/C10H18N2O4S/c13-10(9-7-16-4-3-11-9)12-6-8-2-1-5-17(8,14)15/h8-9,11H,1-7H2,(H,12,13) |
| InChIKey | ZCIGWYBZSXHVBK-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |