C12H13BrN2O2S2 — CID 81040121
5-bromo-3-[(1,1-dioxothiolan-2-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 81040121) has the molecular formula C12H13BrN2O2S2 and a molecular weight of 361.29 g/mol. Its IUPAC name is 5-bromo-3-[(1,1-dioxothiolan-2-yl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 5-bromo-3-[(1,1-dioxothiolan-2-yl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 81040121 |
| Molecular Formula | C12H13BrN2O2S2 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 5-bromo-3-[(1,1-dioxothiolan-2-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | O=S1(=O)CCCC1Cn1c(=S)[nH]c2ccc(Br)cc21 |
| InChI | InChI=1S/C12H13BrN2O2S2/c13-8-3-4-10-11(6-8)15(12(18)14-10)7-9-2-1-5-19(9,16)17/h3-4,6,9H,1-2,5,7H2,(H,14,18) |
| InChIKey | MVRAFSNLAGOWNB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|