C14H17ClN2O2S — CID 81040364
2-[[2-(2-chloroethyl)benzimidazol-1-yl]methyl]thiolane 1,1-dioxide (PubChem CID 81040364) has the molecular formula C14H17ClN2O2S and a molecular weight of 312.82 g/mol. Its IUPAC name is 2-[[2-(2-chloroethyl)benzimidazol-1-yl]methyl]thiolane 1,1-dioxide.
| Compound Name | 2-[[2-(2-chloroethyl)benzimidazol-1-yl]methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 81040364 |
| Molecular Formula | C14H17ClN2O2S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-[[2-(2-chloroethyl)benzimidazol-1-yl]methyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC1Cn1c(CCCl)nc2ccccc21 |
| InChI | InChI=1S/C14H17ClN2O2S/c15-8-7-14-16-12-5-1-2-6-13(12)17(14)10-11-4-3-9-20(11,18)19/h1-2,5-6,11H,3-4,7-10H2 |
| InChIKey | XWMQXNDSHTVLDO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|