C11H16N2O5S — CID 81040501
2-[(1,1-dioxothiolan-2-yl)methylcarbamoyl-prop-2-ynylamino]acetic acid (PubChem CID 81040501) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-2-yl)methylcarbamoyl-prop-2-ynylamino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-2-yl)methylcarbamoyl-prop-2-ynylamino]acetic acid |
|---|---|
| PubChem CID | 81040501 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-[(1,1-dioxothiolan-2-yl)methylcarbamoyl-prop-2-ynylamino]acetic acid |
| SMILES | C#CCN(CC(=O)O)C(=O)NCC1CCCS1(=O)=O |
| InChI | InChI=1S/C11H16N2O5S/c1-2-5-13(8-10(14)15)11(16)12-7-9-4-3-6-19(9,17)18/h1,9H,3-8H2,(H,12,16)(H,14,15) |
| InChIKey | GAJDBEXSNDRCTL-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|