C14H15FN2O3 — CID 81042197
1-ethyl-3-(2-fluoro-4,5-dimethoxyphenyl)pyrazole-4-carbaldehyde (PubChem CID 81042197) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 1-ethyl-3-(2-fluoro-4,5-dimethoxyphenyl)pyrazole-4-carbaldehyde.
| Compound Name | 1-ethyl-3-(2-fluoro-4,5-dimethoxyphenyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 81042197 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-ethyl-3-(2-fluoro-4,5-dimethoxyphenyl)pyrazole-4-carbaldehyde |
| SMILES | CCn1cc(C=O)c(-c2cc(OC)c(OC)cc2F)n1 |
| InChI | InChI=1S/C14H15FN2O3/c1-4-17-7-9(8-18)14(16-17)10-5-12(19-2)13(20-3)6-11(10)15/h5-8H,4H2,1-3H3 |
| InChIKey | FECQZPXLQNJUJP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|