About 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde
3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde (PubChem CID 81042479) has the molecular formula C15H17FN2O3
and a molecular weight of 292.31 g/mol. Its IUPAC name is 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde |
| PubChem CID | 81042479 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde |
| SMILES | CCCn1cc(C=O)c(-c2cc(OC)c(OC)cc2F)n1 |
| InChI | InChI=1S/C15H17FN2O3/c1-4-5-18-8-10(9-19)15(17-18)11-6-13(20-2)14(21-3)7-12(11)16/h6-9H,4-5H2,1-3H3 |
| InChIKey | VBBYZQMODQPOJW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde?
The IUPAC name of 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde (CID 81042479) is 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde.
What is the SMILES notation for 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde?
The canonical SMILES for 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde is CCCn1cc(C=O)c(-c2cc(OC)c(OC)cc2F)n1.
What is the InChIKey of 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde?
The InChIKey is VBBYZQMODQPOJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN2O3/c1-4-5-18-8-10(9-19)15(17-18)11-6-13(20-2)14(21-3)7-12(11)16/h6-9H,4-5H2,1-3H3.
What are the key properties of 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde?
3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde has a molecular weight of 292.31 g/mol, XLogP of 2.93, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluoro-4,5-dimethoxyphenyl)-1-propylpyrazole-4-carbaldehyde is sourced from PubChem (CID 81042479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).