C14H26N2O4S — CID 81043263
3-(1-piperidin-1-ylsulfonylpiperidin-3-yl)butanoic acid (PubChem CID 81043263) has the molecular formula C14H26N2O4S and a molecular weight of 318.44 g/mol. Its IUPAC name is 3-(1-piperidin-1-ylsulfonylpiperidin-3-yl)butanoic acid.
| Compound Name | 3-(1-piperidin-1-ylsulfonylpiperidin-3-yl)butanoic acid |
|---|---|
| PubChem CID | 81043263 |
| Molecular Formula | C14H26N2O4S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-(1-piperidin-1-ylsulfonylpiperidin-3-yl)butanoic acid |
| SMILES | CC(CC(=O)O)C1CCCN(S(=O)(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C14H26N2O4S/c1-12(10-14(17)18)13-6-5-9-16(11-13)21(19,20)15-7-3-2-4-8-15/h12-13H,2-11H2,1H3,(H,17,18) |
| InChIKey | IVISBBVGEXRGQB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |