C13H19ClN4O2S — CID 81043392
2-[[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]methyl]thiolane 1,1-dioxide (PubChem CID 81043392) has the molecular formula C13H19ClN4O2S and a molecular weight of 330.84 g/mol. Its IUPAC name is 2-[[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]methyl]thiolane 1,1-dioxide.
| Compound Name | 2-[[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 81043392 |
| Molecular Formula | C13H19ClN4O2S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-[[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]methyl]thiolane 1,1-dioxide |
| SMILES | Cc1nn(C)c2c1nc(C(C)Cl)n2CC1CCCS1(=O)=O |
| InChI | InChI=1S/C13H19ClN4O2S/c1-8(14)12-15-11-9(2)16-17(3)13(11)18(12)7-10-5-4-6-21(10,19)20/h8,10H,4-7H2,1-3H3 |
| InChIKey | FVVSGDLXHJYLCX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|