C15H23NO3 — CID 81046699
3-[1-[(4E)-hexa-2,4-dienoyl]piperidin-3-yl]butanoic acid (PubChem CID 81046699) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-[1-[(4E)-hexa-2,4-dienoyl]piperidin-3-yl]butanoic acid.
| Compound Name | 3-[1-[(4E)-hexa-2,4-dienoyl]piperidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 81046699 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-[1-[(4E)-hexa-2,4-dienoyl]piperidin-3-yl]butanoic acid |
| SMILES | C/C=C/C=CC(=O)N1CCCC(C(C)CC(=O)O)C1 |
| InChI | InChI=1S/C15H23NO3/c1-3-4-5-8-14(17)16-9-6-7-13(11-16)12(2)10-15(18)19/h3-5,8,12-13H,6-7,9-11H2,1-2H3,(H,18,19)/b4-3+,8-5? |
| InChIKey | VYBWHERIYJWUFF-JOQXGHDDSA-N |
| XLogP | 2.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|