C12H18ClN3O2S — CID 81046878
3-[1-[(5-chlorothiadiazol-4-yl)methyl]piperidin-3-yl]butanoic acid (PubChem CID 81046878) has the molecular formula C12H18ClN3O2S and a molecular weight of 303.82 g/mol. Its IUPAC name is 3-[1-[(5-chlorothiadiazol-4-yl)methyl]piperidin-3-yl]butanoic acid.
| Compound Name | 3-[1-[(5-chlorothiadiazol-4-yl)methyl]piperidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 81046878 |
| Molecular Formula | C12H18ClN3O2S |
| Molecular Weight | 303.82 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-[1-[(5-chlorothiadiazol-4-yl)methyl]piperidin-3-yl]butanoic acid |
| SMILES | CC(CC(=O)O)C1CCCN(Cc2nnsc2Cl)C1 |
| InChI | InChI=1S/C12H18ClN3O2S/c1-8(5-11(17)18)9-3-2-4-16(6-9)7-10-12(13)19-15-14-10/h8-9H,2-7H2,1H3,(H,17,18) |
| InChIKey | DVLOSJRQAJXKGP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |