C13H16BrNS — CID 81049120
N-[(5-bromo-3-methyl-1-benzothiophen-2-yl)methyl]propan-1-amine (PubChem CID 81049120) has the molecular formula C13H16BrNS and a molecular weight of 298.25 g/mol. Its IUPAC name is N-[(5-bromo-3-methyl-1-benzothiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromo-3-methyl-1-benzothiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 81049120 |
| Molecular Formula | C13H16BrNS |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | N-[(5-bromo-3-methyl-1-benzothiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1sc2ccc(Br)cc2c1C |
| InChI | InChI=1S/C13H16BrNS/c1-3-6-15-8-13-9(2)11-7-10(14)4-5-12(11)16-13/h4-5,7,15H,3,6,8H2,1-2H3 |
| InChIKey | NJXVJTWOOQGRPS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|