C10H8Br2S — CID 131030787
2,5-dibromo-3-ethyl-1-benzothiophene (PubChem CID 131030787) has the molecular formula C10H8Br2S and a molecular weight of 320.05 g/mol. Its IUPAC name is 2,5-dibromo-3-ethyl-1-benzothiophene.
| Compound Name | 2,5-dibromo-3-ethyl-1-benzothiophene |
|---|---|
| PubChem CID | 131030787 |
| Molecular Formula | C10H8Br2S |
| Molecular Weight | 320.05 g/mol |
| Exact Mass | 317.87 |
| IUPAC Name | 2,5-dibromo-3-ethyl-1-benzothiophene |
| SMILES | CCc1c(Br)sc2ccc(Br)cc12 |
| InChI | InChI=1S/C10H8Br2S/c1-2-7-8-5-6(11)3-4-9(8)13-10(7)12/h3-5H,2H2,1H3 |
| InChIKey | ATRDLXBIPIDDQK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.05 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |