C18H18Br2OS — CID 141331169
2,8-dibromo-1-hexoxydibenzothiophene (PubChem CID 141331169) has the molecular formula C18H18Br2OS and a molecular weight of 442.22 g/mol. Its IUPAC name is 2,8-dibromo-1-hexoxydibenzothiophene.
| Compound Name | 2,8-dibromo-1-hexoxydibenzothiophene |
|---|---|
| PubChem CID | 141331169 |
| Molecular Formula | C18H18Br2OS |
| Molecular Weight | 442.22 g/mol |
| Exact Mass | 439.94 |
| IUPAC Name | 2,8-dibromo-1-hexoxydibenzothiophene |
| SMILES | CCCCCCOc1c(Br)ccc2sc3ccc(Br)cc3c12 |
| InChI | InChI=1S/C18H18Br2OS/c1-2-3-4-5-10-21-18-14(20)7-9-16-17(18)13-11-12(19)6-8-15(13)22-16/h6-9,11H,2-5,10H2,1H3 |
| InChIKey | GLXRPFGPFMITAS-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.22 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|