About [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine
[2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine (PubChem CID 81050953) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine |
| PubChem CID | 81050953 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine |
| SMILES | Cc1cc(OCCN2CCCC2)c(CN)c(C)n1 |
| InChI | InChI=1S/C14H23N3O/c1-11-9-14(13(10-15)12(2)16-11)18-8-7-17-5-3-4-6-17/h9H,3-8,10,15H2,1-2H3 |
| InChIKey | LZWCOJHDHOTWBZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine?
The IUPAC name of [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine (CID 81050953) is [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine.
What is the SMILES notation for [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine?
The canonical SMILES for [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine is Cc1cc(OCCN2CCCC2)c(CN)c(C)n1.
What is the InChIKey of [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine?
The InChIKey is LZWCOJHDHOTWBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O/c1-11-9-14(13(10-15)12(2)16-11)18-8-7-17-5-3-4-6-17/h9H,3-8,10,15H2,1-2H3.
What are the key properties of [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine?
[2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine has a molecular weight of 249.36 g/mol, XLogP of 1.63, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]methanamine is sourced from PubChem (CID 81050953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).