C10H20N2O2S — CID 81056262
3-amino-N-(2-ethoxyethyl)-N,2,2-trimethyl-3-sulfanylidenepropanamide (PubChem CID 81056262) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 3-amino-N-(2-ethoxyethyl)-N,2,2-trimethyl-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(2-ethoxyethyl)-N,2,2-trimethyl-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 81056262 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-amino-N-(2-ethoxyethyl)-N,2,2-trimethyl-3-sulfanylidenepropanamide |
| SMILES | CCOCCN(C)C(=O)C(C)(C)C(N)=S |
| InChI | InChI=1S/C10H20N2O2S/c1-5-14-7-6-12(4)9(13)10(2,3)8(11)15/h5-7H2,1-4H3,(H2,11,15) |
| InChIKey | HPFSYTXALHPUMR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|