C15H18N4 — CID 81057061
3-(2,3-dihydro-1H-indol-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 81057061) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-(2,3-dihydro-1H-indol-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 81057061 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | c1ccc2c(c1)NCC2Cc1nnc2n1CCCC2 |
| InChI | InChI=1S/C15H18N4/c1-2-6-13-12(5-1)11(10-16-13)9-15-18-17-14-7-3-4-8-19(14)15/h1-2,5-6,11,16H,3-4,7-10H2 |
| InChIKey | AGHREJOXBVBKIU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |