C14H16N4 — CID 81058149
3-(2,3-dihydro-1H-indol-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 81058149) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-(2,3-dihydro-1H-indol-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 81058149 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | c1ccc2c(c1)CC(c1nnc3n1CCCC3)N2 |
| InChI | InChI=1S/C14H16N4/c1-2-6-11-10(5-1)9-12(15-11)14-17-16-13-7-3-4-8-18(13)14/h1-2,5-6,12,15H,3-4,7-9H2 |
| InChIKey | KUNRGRDRWSPMKS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |