C11H25N3O2 — CID 81059610
4-amino-3-[2-ethoxyethyl(methyl)amino]-N,N-dimethylbutanamide (PubChem CID 81059610) has the molecular formula C11H25N3O2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-amino-3-[2-ethoxyethyl(methyl)amino]-N,N-dimethylbutanamide.
| Compound Name | 4-amino-3-[2-ethoxyethyl(methyl)amino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 81059610 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 4-amino-3-[2-ethoxyethyl(methyl)amino]-N,N-dimethylbutanamide |
| SMILES | CCOCCN(C)C(CN)CC(=O)N(C)C |
| InChI | InChI=1S/C11H25N3O2/c1-5-16-7-6-14(4)10(9-12)8-11(15)13(2)3/h10H,5-9,12H2,1-4H3 |
| InChIKey | DJFJDGMALKLQOU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|