C11H26N2O3 — CID 81058494
2-N-(2-ethoxyethyl)-4,4-dimethoxy-2-N-methylbutane-1,2-diamine (PubChem CID 81058494) has the molecular formula C11H26N2O3 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-N-(2-ethoxyethyl)-4,4-dimethoxy-2-N-methylbutane-1,2-diamine.
| Compound Name | 2-N-(2-ethoxyethyl)-4,4-dimethoxy-2-N-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 81058494 |
| Molecular Formula | C11H26N2O3 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | 2-N-(2-ethoxyethyl)-4,4-dimethoxy-2-N-methylbutane-1,2-diamine |
| SMILES | CCOCCN(C)C(CN)CC(OC)OC |
| InChI | InChI=1S/C11H26N2O3/c1-5-16-7-6-13(2)10(9-12)8-11(14-3)15-4/h10-11H,5-9,12H2,1-4H3 |
| InChIKey | AMJZFEYSVNPAKL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|