C13H30N2O4 — CID 66268426
4,4-dimethoxy-2-N-(2-methoxyethyl)-2-N-(3-methoxypropyl)butane-1,2-diamine (PubChem CID 66268426) has the molecular formula C13H30N2O4 and a molecular weight of 278.39 g/mol. Its IUPAC name is 4,4-dimethoxy-2-N-(2-methoxyethyl)-2-N-(3-methoxypropyl)butane-1,2-diamine.
| Compound Name | 4,4-dimethoxy-2-N-(2-methoxyethyl)-2-N-(3-methoxypropyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 66268426 |
| Molecular Formula | C13H30N2O4 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 4,4-dimethoxy-2-N-(2-methoxyethyl)-2-N-(3-methoxypropyl)butane-1,2-diamine |
| SMILES | COCCCN(CCOC)C(CN)CC(OC)OC |
| InChI | InChI=1S/C13H30N2O4/c1-16-8-5-6-15(7-9-17-2)12(11-14)10-13(18-3)19-4/h12-13H,5-11,14H2,1-4H3 |
| InChIKey | CCFVXRWENAQPLJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|