C12H29N3O2 — CID 66268623
2-N-[3-(dimethylamino)propyl]-4,4-dimethoxy-2-N-methylbutane-1,2-diamine (PubChem CID 66268623) has the molecular formula C12H29N3O2 and a molecular weight of 247.38 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-4,4-dimethoxy-2-N-methylbutane-1,2-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-4,4-dimethoxy-2-N-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 66268623 |
| Molecular Formula | C12H29N3O2 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-4,4-dimethoxy-2-N-methylbutane-1,2-diamine |
| SMILES | COC(CC(CN)N(C)CCCN(C)C)OC |
| InChI | InChI=1S/C12H29N3O2/c1-14(2)7-6-8-15(3)11(10-13)9-12(16-4)17-5/h11-12H,6-10,13H2,1-5H3 |
| InChIKey | RUYDMFMJLUXCRS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|