C14H26N2O3S2 — CID 81064546
N-methyl-4-[(propan-2-ylamino)methyl]-N-(2-propan-2-yloxyethyl)thiophene-2-sulfonamide (PubChem CID 81064546) has the molecular formula C14H26N2O3S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is N-methyl-4-[(propan-2-ylamino)methyl]-N-(2-propan-2-yloxyethyl)thiophene-2-sulfonamide.
| Compound Name | N-methyl-4-[(propan-2-ylamino)methyl]-N-(2-propan-2-yloxyethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 81064546 |
| Molecular Formula | C14H26N2O3S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-methyl-4-[(propan-2-ylamino)methyl]-N-(2-propan-2-yloxyethyl)thiophene-2-sulfonamide |
| SMILES | CC(C)NCc1csc(S(=O)(=O)N(C)CCOC(C)C)c1 |
| InChI | InChI=1S/C14H26N2O3S2/c1-11(2)15-9-13-8-14(20-10-13)21(17,18)16(5)6-7-19-12(3)4/h8,10-12,15H,6-7,9H2,1-5H3 |
| InChIKey | MVPOKXLMONLWEP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |