C11H19ClN2O3S — CID 81064720
5-(chloromethyl)-N-(2-ethoxyethyl)-N,1-dimethylpyrrole-3-sulfonamide (PubChem CID 81064720) has the molecular formula C11H19ClN2O3S and a molecular weight of 294.80 g/mol. Its IUPAC name is 5-(chloromethyl)-N-(2-ethoxyethyl)-N,1-dimethylpyrrole-3-sulfonamide.
| Compound Name | 5-(chloromethyl)-N-(2-ethoxyethyl)-N,1-dimethylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 81064720 |
| Molecular Formula | C11H19ClN2O3S |
| Molecular Weight | 294.80 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 5-(chloromethyl)-N-(2-ethoxyethyl)-N,1-dimethylpyrrole-3-sulfonamide |
| SMILES | CCOCCN(C)S(=O)(=O)c1cc(CCl)n(C)c1 |
| InChI | InChI=1S/C11H19ClN2O3S/c1-4-17-6-5-14(3)18(15,16)11-7-10(8-12)13(2)9-11/h7,9H,4-6,8H2,1-3H3 |
| InChIKey | HCHJNXGZWVWNDU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.80 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|