C13H23ClN2O3S — CID 81064068
5-(chloromethyl)-N-(2-ethoxyethyl)-N-methyl-1-propan-2-ylpyrrole-3-sulfonamide (PubChem CID 81064068) has the molecular formula C13H23ClN2O3S and a molecular weight of 322.86 g/mol. Its IUPAC name is 5-(chloromethyl)-N-(2-ethoxyethyl)-N-methyl-1-propan-2-ylpyrrole-3-sulfonamide.
| Compound Name | 5-(chloromethyl)-N-(2-ethoxyethyl)-N-methyl-1-propan-2-ylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 81064068 |
| Molecular Formula | C13H23ClN2O3S |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 5-(chloromethyl)-N-(2-ethoxyethyl)-N-methyl-1-propan-2-ylpyrrole-3-sulfonamide |
| SMILES | CCOCCN(C)S(=O)(=O)c1cc(CCl)n(C(C)C)c1 |
| InChI | InChI=1S/C13H23ClN2O3S/c1-5-19-7-6-15(4)20(17,18)13-8-12(9-14)16(10-13)11(2)3/h8,10-11H,5-7,9H2,1-4H3 |
| InChIKey | IYRJYGFPWQASJC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|