C11H20N2O2 — CID 81067939
N-[[4-(aminomethyl)furan-2-yl]methyl]-2-ethoxy-N-methylethanamine (PubChem CID 81067939) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is N-[[4-(aminomethyl)furan-2-yl]methyl]-2-ethoxy-N-methylethanamine.
| Compound Name | N-[[4-(aminomethyl)furan-2-yl]methyl]-2-ethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 81067939 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N-[[4-(aminomethyl)furan-2-yl]methyl]-2-ethoxy-N-methylethanamine |
| SMILES | CCOCCN(C)Cc1cc(CN)co1 |
| InChI | InChI=1S/C11H20N2O2/c1-3-14-5-4-13(2)8-11-6-10(7-12)9-15-11/h6,9H,3-5,7-8,12H2,1-2H3 |
| InChIKey | YDACJGINVVJYLK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|