C10H17NO3 — CID 62444313
[5-(2-ethoxyethoxymethyl)furan-3-yl]methanamine (PubChem CID 62444313) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is [5-(2-ethoxyethoxymethyl)furan-3-yl]methanamine.
| Compound Name | [5-(2-ethoxyethoxymethyl)furan-3-yl]methanamine |
|---|---|
| PubChem CID | 62444313 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | [5-(2-ethoxyethoxymethyl)furan-3-yl]methanamine |
| SMILES | CCOCCOCc1cc(CN)co1 |
| InChI | InChI=1S/C10H17NO3/c1-2-12-3-4-13-8-10-5-9(6-11)7-14-10/h5,7H,2-4,6,8,11H2,1H3 |
| InChIKey | GIMYJSRHGQLLER-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|