C11H19NO2 — CID 62444987
[5-(3-methylbutoxymethyl)furan-3-yl]methanamine (PubChem CID 62444987) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is [5-(3-methylbutoxymethyl)furan-3-yl]methanamine.
| Compound Name | [5-(3-methylbutoxymethyl)furan-3-yl]methanamine |
|---|---|
| PubChem CID | 62444987 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | [5-(3-methylbutoxymethyl)furan-3-yl]methanamine |
| SMILES | CC(C)CCOCc1cc(CN)co1 |
| InChI | InChI=1S/C11H19NO2/c1-9(2)3-4-13-8-11-5-10(6-12)7-14-11/h5,7,9H,3-4,6,8,12H2,1-2H3 |
| InChIKey | WRQAOWKYDRSBHD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|