C8H15NO4S — CID 81080047
3-methoxy-2-(3-methylsulfanylpropanoylamino)propanoic acid (PubChem CID 81080047) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-methoxy-2-(3-methylsulfanylpropanoylamino)propanoic acid.
| Compound Name | 3-methoxy-2-(3-methylsulfanylpropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 81080047 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 3-methoxy-2-(3-methylsulfanylpropanoylamino)propanoic acid |
| SMILES | COCC(NC(=O)CCSC)C(=O)O |
| InChI | InChI=1S/C8H15NO4S/c1-13-5-6(8(11)12)9-7(10)3-4-14-2/h6H,3-5H2,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | MBJTVSQLMGBKHW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |