C12H19N3O4S — CID 81089320
2-[[(2-amino-5-methoxypentanoyl)amino]methyl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 81089320) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[[(2-amino-5-methoxypentanoyl)amino]methyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[(2-amino-5-methoxypentanoyl)amino]methyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 81089320 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[[(2-amino-5-methoxypentanoyl)amino]methyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | COCCCC(N)C(=O)NCc1nc(C)c(C(=O)O)s1 |
| InChI | InChI=1S/C12H19N3O4S/c1-7-10(12(17)18)20-9(15-7)6-14-11(16)8(13)4-3-5-19-2/h8H,3-6,13H2,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | PEKSQVRFMAZNOE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|