C10H22N2O2 — CID 81093197
N-(2,2-dimethoxyethyl)-N-propylazetidin-3-amine (PubChem CID 81093197) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-propylazetidin-3-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-N-propylazetidin-3-amine |
|---|---|
| PubChem CID | 81093197 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-propylazetidin-3-amine |
| SMILES | CCCN(CC(OC)OC)C1CNC1 |
| InChI | InChI=1S/C10H22N2O2/c1-4-5-12(9-6-11-7-9)8-10(13-2)14-3/h9-11H,4-8H2,1-3H3 |
| InChIKey | WFUIQQQPMCWORY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|