About 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine
1-(3,3-diethoxypropyl)-2,5-diethylpiperazine (PubChem CID 81093832) has the molecular formula C15H32N2O2
and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine.
Molecular Properties
| Compound Name | 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine |
| PubChem CID | 81093832 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine |
| SMILES | CCOC(CCN1CC(CC)NCC1CC)OCC |
| InChI | InChI=1S/C15H32N2O2/c1-5-13-12-17(14(6-2)11-16-13)10-9-15(18-7-3)19-8-4/h13-16H,5-12H2,1-4H3 |
| InChIKey | KIPNHLMXJIRXMR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine?
The IUPAC name of 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine (CID 81093832) is 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine.
What is the SMILES notation for 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine?
The canonical SMILES for 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine is CCOC(CCN1CC(CC)NCC1CC)OCC.
What is the InChIKey of 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine?
The InChIKey is KIPNHLMXJIRXMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O2/c1-5-13-12-17(14(6-2)11-16-13)10-9-15(18-7-3)19-8-4/h13-16H,5-12H2,1-4H3.
What are the key properties of 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine?
1-(3,3-diethoxypropyl)-2,5-diethylpiperazine has a molecular weight of 272.43 g/mol, XLogP of 2.24, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diethoxypropyl)-2,5-diethylpiperazine is sourced from PubChem (CID 81093832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).