C13H27NO3 — CID 81094779
N-(3,3-diethoxypropyl)-2-methoxycyclopentan-1-amine (PubChem CID 81094779) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-2-methoxycyclopentan-1-amine.
| Compound Name | N-(3,3-diethoxypropyl)-2-methoxycyclopentan-1-amine |
|---|---|
| PubChem CID | 81094779 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | N-(3,3-diethoxypropyl)-2-methoxycyclopentan-1-amine |
| SMILES | CCOC(CCNC1CCCC1OC)OCC |
| InChI | InChI=1S/C13H27NO3/c1-4-16-13(17-5-2)9-10-14-11-7-6-8-12(11)15-3/h11-14H,4-10H2,1-3H3 |
| InChIKey | GVSQNAOMCHMOTB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|