C13H29NO2 — CID 81094934
N-(2,2-diethoxyethyl)-4-methylhexan-2-amine (PubChem CID 81094934) has the molecular formula C13H29NO2 and a molecular weight of 231.38 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-4-methylhexan-2-amine.
| Compound Name | N-(2,2-diethoxyethyl)-4-methylhexan-2-amine |
|---|---|
| PubChem CID | 81094934 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | N-(2,2-diethoxyethyl)-4-methylhexan-2-amine |
| SMILES | CCOC(CNC(C)CC(C)CC)OCC |
| InChI | InChI=1S/C13H29NO2/c1-6-11(4)9-12(5)14-10-13(15-7-2)16-8-3/h11-14H,6-10H2,1-5H3 |
| InChIKey | AZLPMDONDCGGEM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|